C16H17BrN2O3S — CID 4961119
N'-[2-(4-bromo-2,6-dimethylphenoxy)propanoyl]thiophene-2-carbohydrazide (PubChem CID 4961119) has the molecular formula C16H17BrN2O3S and a molecular weight of 397.29 g/mol. Its IUPAC name is N'-[2-(4-bromo-2,6-dimethylphenoxy)propanoyl]thiophene-2-carbohydrazide.
| Compound Name | N'-[2-(4-bromo-2,6-dimethylphenoxy)propanoyl]thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 4961119 |
| Molecular Formula | C16H17BrN2O3S |
| Molecular Weight | 397.29 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | N'-[2-(4-bromo-2,6-dimethylphenoxy)propanoyl]thiophene-2-carbohydrazide |
| SMILES | Cc1cc(Br)cc(C)c1OC(C)C(=O)NNC(=O)c1cccs1 |
| InChI | InChI=1S/C16H17BrN2O3S/c1-9-7-12(17)8-10(2)14(9)22-11(3)15(20)18-19-16(21)13-5-4-6-23-13/h4-8,11H,1-3H3,(H,18,20)(H,19,21) |
| InChIKey | GOMFLETYCMEPJS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.29 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|