About 4H-thieno[3,2-b]pyrrole-5-carboxylic acid
4H-thieno[3,2-b]pyrrole-5-carboxylic acid (PubChem CID 4961254) has the molecular formula C7H5NO2S
and a molecular weight of 167.19 g/mol. Its IUPAC name is 4H-thieno[3,2-b]pyrrole-5-carboxylic acid.
Molecular Properties
| Compound Name | 4H-thieno[3,2-b]pyrrole-5-carboxylic acid |
| PubChem CID | 4961254 |
| Molecular Formula | C7H5NO2S |
| Molecular Weight | 167.19 g/mol |
| Exact Mass | 167.00 |
| IUPAC Name | 4H-thieno[3,2-b]pyrrole-5-carboxylic acid |
| SMILES | O=C(O)c1cc2sccc2[nH]1 |
| InChI | InChI=1S/C7H5NO2S/c9-7(10)5-3-6-4(8-5)1-2-11-6/h1-3,8H,(H,9,10) |
| InChIKey | PMHDSACGRKBACK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.19 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4H-thieno[3,2-b]pyrrole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-thieno[3,2-b]pyrrole-5-carboxylic acid?
The IUPAC name of 4H-thieno[3,2-b]pyrrole-5-carboxylic acid (CID 4961254) is 4H-thieno[3,2-b]pyrrole-5-carboxylic acid.
What is the SMILES notation for 4H-thieno[3,2-b]pyrrole-5-carboxylic acid?
The canonical SMILES for 4H-thieno[3,2-b]pyrrole-5-carboxylic acid is O=C(O)c1cc2sccc2[nH]1.
What is the InChIKey of 4H-thieno[3,2-b]pyrrole-5-carboxylic acid?
The InChIKey is PMHDSACGRKBACK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO2S/c9-7(10)5-3-6-4(8-5)1-2-11-6/h1-3,8H,(H,9,10).
What are the key properties of 4H-thieno[3,2-b]pyrrole-5-carboxylic acid?
4H-thieno[3,2-b]pyrrole-5-carboxylic acid has a molecular weight of 167.19 g/mol, XLogP of 1.93, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-thieno[3,2-b]pyrrole-5-carboxylic acid is sourced from PubChem (CID 4961254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).