About 2,3-dihydroisoquinoline
2,3-dihydroisoquinoline (PubChem CID 4961379) has the molecular formula C9H9N
and a molecular weight of 131.18 g/mol. Its IUPAC name is 2,3-dihydroisoquinoline.
Molecular Properties
| Compound Name | 2,3-dihydroisoquinoline |
| PubChem CID | 4961379 |
| Molecular Formula | C9H9N |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.07 |
| IUPAC Name | 2,3-dihydroisoquinoline |
| SMILES | C1=c2ccccc2=CNC1 |
| InChI | InChI=1S/C9H9N/c1-2-4-9-7-10-6-5-8(9)3-1/h1-5,7,10H,6H2 |
| InChIKey | FZWSBCNMDDULHX-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,3-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dihydroisoquinoline?
The IUPAC name of 2,3-dihydroisoquinoline (CID 4961379) is 2,3-dihydroisoquinoline.
What is the SMILES notation for 2,3-dihydroisoquinoline?
The canonical SMILES for 2,3-dihydroisoquinoline is C1=c2ccccc2=CNC1.
What is the InChIKey of 2,3-dihydroisoquinoline?
The InChIKey is FZWSBCNMDDULHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N/c1-2-4-9-7-10-6-5-8(9)3-1/h1-5,7,10H,6H2.
What are the key properties of 2,3-dihydroisoquinoline?
2,3-dihydroisoquinoline has a molecular weight of 131.18 g/mol, XLogP of -0.19, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroisoquinoline is sourced from PubChem (CID 4961379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).