About 10-benzyl-3,3-difluoro-5-methyl-2,4-dioxa-10-aza-3-boranuidabicyclo[4.4.0]decane
10-benzyl-3,3-difluoro-5-methyl-2,4-dioxa-10-aza-3-boranuidabicyclo[4.4.0]decane (PubChem CID 4961515) has the molecular formula C14H19BF2NO2-
and a molecular weight of 282.12 g/mol. Its IUPAC name is 10-benzyl-3,3-difluoro-5-methyl-2,4-dioxa-10-aza-3-boranuidabicyclo[4.4.0]decane.
Molecular Properties
| Compound Name | 10-benzyl-3,3-difluoro-5-methyl-2,4-dioxa-10-aza-3-boranuidabicyclo[4.4.0]decane |
| PubChem CID | 4961515 |
| Molecular Formula | C14H19BF2NO2- |
| Molecular Weight | 282.12 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 10-benzyl-3,3-difluoro-5-methyl-2,4-dioxa-10-aza-3-boranuidabicyclo[4.4.0]decane |
| SMILES | CC1O[B-](F)(F)OC2C1CCCN2Cc1ccccc1 |
| InChI | InChI=1S/C14H19BF2NO2/c1-11-13-8-5-9-18(10-12-6-3-2-4-7-12)14(13)20-15(16,17)19-11/h2-4,6-7,11,13-14H,5,8-10H2,1H3/q-1 |
| InChIKey | MTMMZCUJLATTTJ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.12 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 10-benzyl-3,3-difluoro-5-methyl-2,4-dioxa-10-aza-3-boranuidabicyclo[4.4.0]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-benzyl-3,3-difluoro-5-methyl-2,4-dioxa-10-aza-3-boranuidabicyclo[4.4.0]decane?
The IUPAC name of 10-benzyl-3,3-difluoro-5-methyl-2,4-dioxa-10-aza-3-boranuidabicyclo[4.4.0]decane (CID 4961515) is 10-benzyl-3,3-difluoro-5-methyl-2,4-dioxa-10-aza-3-boranuidabicyclo[4.4.0]decane.
What is the SMILES notation for 10-benzyl-3,3-difluoro-5-methyl-2,4-dioxa-10-aza-3-boranuidabicyclo[4.4.0]decane?
The canonical SMILES for 10-benzyl-3,3-difluoro-5-methyl-2,4-dioxa-10-aza-3-boranuidabicyclo[4.4.0]decane is CC1O[B-](F)(F)OC2C1CCCN2Cc1ccccc1.
What is the InChIKey of 10-benzyl-3,3-difluoro-5-methyl-2,4-dioxa-10-aza-3-boranuidabicyclo[4.4.0]decane?
The InChIKey is MTMMZCUJLATTTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19BF2NO2/c1-11-13-8-5-9-18(10-12-6-3-2-4-7-12)14(13)20-15(16,17)19-11/h2-4,6-7,11,13-14H,5,8-10H2,1H3/q-1.
What are the key properties of 10-benzyl-3,3-difluoro-5-methyl-2,4-dioxa-10-aza-3-boranuidabicyclo[4.4.0]decane?
10-benzyl-3,3-difluoro-5-methyl-2,4-dioxa-10-aza-3-boranuidabicyclo[4.4.0]decane has a molecular weight of 282.12 g/mol, XLogP of 3.03, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-benzyl-3,3-difluoro-5-methyl-2,4-dioxa-10-aza-3-boranuidabicyclo[4.4.0]decane is sourced from PubChem (CID 4961515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).