About 6-phenylimidazo[2,1-b][1,3]thiazol-5-amine
6-phenylimidazo[2,1-b][1,3]thiazol-5-amine (PubChem CID 4961665) has the molecular formula C11H9N3S
and a molecular weight of 215.28 g/mol. Its IUPAC name is 6-phenylimidazo[2,1-b][1,3]thiazol-5-amine.
Molecular Properties
| Compound Name | 6-phenylimidazo[2,1-b][1,3]thiazol-5-amine |
| PubChem CID | 4961665 |
| Molecular Formula | C11H9N3S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.05 |
| IUPAC Name | 6-phenylimidazo[2,1-b][1,3]thiazol-5-amine |
| SMILES | Nc1c(-c2ccccc2)nc2sccn12 |
| InChI | InChI=1S/C11H9N3S/c12-10-9(8-4-2-1-3-5-8)13-11-14(10)6-7-15-11/h1-7H,12H2 |
| InChIKey | PBWGCNFJKNQDGV-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-phenylimidazo[2,1-b][1,3]thiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenylimidazo[2,1-b][1,3]thiazol-5-amine?
The IUPAC name of 6-phenylimidazo[2,1-b][1,3]thiazol-5-amine (CID 4961665) is 6-phenylimidazo[2,1-b][1,3]thiazol-5-amine.
What is the SMILES notation for 6-phenylimidazo[2,1-b][1,3]thiazol-5-amine?
The canonical SMILES for 6-phenylimidazo[2,1-b][1,3]thiazol-5-amine is Nc1c(-c2ccccc2)nc2sccn12.
What is the InChIKey of 6-phenylimidazo[2,1-b][1,3]thiazol-5-amine?
The InChIKey is PBWGCNFJKNQDGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9N3S/c12-10-9(8-4-2-1-3-5-8)13-11-14(10)6-7-15-11/h1-7H,12H2.
What are the key properties of 6-phenylimidazo[2,1-b][1,3]thiazol-5-amine?
6-phenylimidazo[2,1-b][1,3]thiazol-5-amine has a molecular weight of 215.28 g/mol, XLogP of 2.64, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenylimidazo[2,1-b][1,3]thiazol-5-amine is sourced from PubChem (CID 4961665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).