About 2-(chloromethyl)-N,N-dimethyl-1-propylbenzimidazole-5-sulfonamide
2-(chloromethyl)-N,N-dimethyl-1-propylbenzimidazole-5-sulfonamide (PubChem CID 4961788) has the molecular formula C13H18ClN3O2S
and a molecular weight of 315.83 g/mol. Its IUPAC name is 2-(chloromethyl)-N,N-dimethyl-1-propylbenzimidazole-5-sulfonamide.
Molecular Properties
| Compound Name | 2-(chloromethyl)-N,N-dimethyl-1-propylbenzimidazole-5-sulfonamide |
| PubChem CID | 4961788 |
| Molecular Formula | C13H18ClN3O2S |
| Molecular Weight | 315.83 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 2-(chloromethyl)-N,N-dimethyl-1-propylbenzimidazole-5-sulfonamide |
| SMILES | CCCn1c(CCl)nc2cc(S(=O)(=O)N(C)C)ccc21 |
| InChI | InChI=1S/C13H18ClN3O2S/c1-4-7-17-12-6-5-10(20(18,19)16(2)3)8-11(12)15-13(17)9-14/h5-6,8H,4,7,9H2,1-3H3 |
| InChIKey | PRLOTQIWRPSMBV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.83 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(chloromethyl)-N,N-dimethyl-1-propylbenzimidazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(chloromethyl)-N,N-dimethyl-1-propylbenzimidazole-5-sulfonamide?
The IUPAC name of 2-(chloromethyl)-N,N-dimethyl-1-propylbenzimidazole-5-sulfonamide (CID 4961788) is 2-(chloromethyl)-N,N-dimethyl-1-propylbenzimidazole-5-sulfonamide.
What is the SMILES notation for 2-(chloromethyl)-N,N-dimethyl-1-propylbenzimidazole-5-sulfonamide?
The canonical SMILES for 2-(chloromethyl)-N,N-dimethyl-1-propylbenzimidazole-5-sulfonamide is CCCn1c(CCl)nc2cc(S(=O)(=O)N(C)C)ccc21.
What is the InChIKey of 2-(chloromethyl)-N,N-dimethyl-1-propylbenzimidazole-5-sulfonamide?
The InChIKey is PRLOTQIWRPSMBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18ClN3O2S/c1-4-7-17-12-6-5-10(20(18,19)16(2)3)8-11(12)15-13(17)9-14/h5-6,8H,4,7,9H2,1-3H3.
What are the key properties of 2-(chloromethyl)-N,N-dimethyl-1-propylbenzimidazole-5-sulfonamide?
2-(chloromethyl)-N,N-dimethyl-1-propylbenzimidazole-5-sulfonamide has a molecular weight of 315.83 g/mol, XLogP of 2.44, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(chloromethyl)-N,N-dimethyl-1-propylbenzimidazole-5-sulfonamide is sourced from PubChem (CID 4961788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).