About 2-azaspiro[4.4]nonane-1,3-dione
2-azaspiro[4.4]nonane-1,3-dione (PubChem CID 4961799) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is 2-azaspiro[4.4]nonane-1,3-dione.
Molecular Properties
| Compound Name | 2-azaspiro[4.4]nonane-1,3-dione |
| PubChem CID | 4961799 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 2-azaspiro[4.4]nonane-1,3-dione |
| SMILES | O=C1CC2(CCCC2)C(=O)N1 |
| InChI | InChI=1S/C8H11NO2/c10-6-5-8(7(11)9-6)3-1-2-4-8/h1-5H2,(H,9,10,11) |
| InChIKey | BGTYXSMQJAWTJV-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-azaspiro[4.4]nonane-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azaspiro[4.4]nonane-1,3-dione?
The IUPAC name of 2-azaspiro[4.4]nonane-1,3-dione (CID 4961799) is 2-azaspiro[4.4]nonane-1,3-dione.
What is the SMILES notation for 2-azaspiro[4.4]nonane-1,3-dione?
The canonical SMILES for 2-azaspiro[4.4]nonane-1,3-dione is O=C1CC2(CCCC2)C(=O)N1.
What is the InChIKey of 2-azaspiro[4.4]nonane-1,3-dione?
The InChIKey is BGTYXSMQJAWTJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2/c10-6-5-8(7(11)9-6)3-1-2-4-8/h1-5H2,(H,9,10,11).
What are the key properties of 2-azaspiro[4.4]nonane-1,3-dione?
2-azaspiro[4.4]nonane-1,3-dione has a molecular weight of 153.18 g/mol, XLogP of 0.59, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azaspiro[4.4]nonane-1,3-dione is sourced from PubChem (CID 4961799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).