2,5-dibromothiophene-3-sulfonyl chloride

C4HBr2ClO2S2 — CID 4961868

IUPAC2,5-dibromothiophene-3-sulfonyl chloride
SMILESO=S(=O)(Cl)c1cc(Br)sc1Br
InChIInChI=1S/C4HBr2ClO2S2/c5-3-1-2(4(6)10-3)11(7,8)9/h1H
InChIKeyNXEZMVJAZXKXHR-UHFFFAOYSA-N
MW340.45 g/mol
LogP3.20
Rot. Bonds1

About 2,5-dibromothiophene-3-sulfonyl chloride

2,5-dibromothiophene-3-sulfonyl chloride (PubChem CID 4961868) has the molecular formula C4HBr2ClO2S2 and a molecular weight of 340.45 g/mol. Its IUPAC name is 2,5-dibromothiophene-3-sulfonyl chloride.

Molecular Properties

Compound Name2,5-dibromothiophene-3-sulfonyl chloride
PubChem CID4961868
Molecular FormulaC4HBr2ClO2S2
Molecular Weight340.45 g/mol
Exact Mass337.75
IUPAC Name2,5-dibromothiophene-3-sulfonyl chloride
SMILESO=S(=O)(Cl)c1cc(Br)sc1Br
InChIInChI=1S/C4HBr2ClO2S2/c5-3-1-2(4(6)10-3)11(7,8)9/h1H
InChIKeyNXEZMVJAZXKXHR-UHFFFAOYSA-N
XLogP3.20
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500340.45
LogP ≤ 53.20
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 2,5-dibromothiophene-3-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,5-dibromothiophene-3-sulfonyl chloride?
The IUPAC name of 2,5-dibromothiophene-3-sulfonyl chloride (CID 4961868) is 2,5-dibromothiophene-3-sulfonyl chloride.
What is the SMILES notation for 2,5-dibromothiophene-3-sulfonyl chloride?
The canonical SMILES for 2,5-dibromothiophene-3-sulfonyl chloride is O=S(=O)(Cl)c1cc(Br)sc1Br.
What is the InChIKey of 2,5-dibromothiophene-3-sulfonyl chloride?
The InChIKey is NXEZMVJAZXKXHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4HBr2ClO2S2/c5-3-1-2(4(6)10-3)11(7,8)9/h1H.
What are the key properties of 2,5-dibromothiophene-3-sulfonyl chloride?
2,5-dibromothiophene-3-sulfonyl chloride has a molecular weight of 340.45 g/mol, XLogP of 3.20, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dibromothiophene-3-sulfonyl chloride is sourced from PubChem (CID 4961868), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).