About 3-amino-4,5-dimethylbenzenesulfonamide
3-amino-4,5-dimethylbenzenesulfonamide (PubChem CID 4961879) has the molecular formula C8H12N2O2S
and a molecular weight of 200.26 g/mol. Its IUPAC name is 3-amino-4,5-dimethylbenzenesulfonamide.
Molecular Properties
| Compound Name | 3-amino-4,5-dimethylbenzenesulfonamide |
| PubChem CID | 4961879 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 3-amino-4,5-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(S(N)(=O)=O)cc(N)c1C |
| InChI | InChI=1S/C8H12N2O2S/c1-5-3-7(13(10,11)12)4-8(9)6(5)2/h3-4H,9H2,1-2H3,(H2,10,11,12) |
| InChIKey | YXQMLWCILAYJQY-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-4,5-dimethylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4,5-dimethylbenzenesulfonamide?
The IUPAC name of 3-amino-4,5-dimethylbenzenesulfonamide (CID 4961879) is 3-amino-4,5-dimethylbenzenesulfonamide.
What is the SMILES notation for 3-amino-4,5-dimethylbenzenesulfonamide?
The canonical SMILES for 3-amino-4,5-dimethylbenzenesulfonamide is Cc1cc(S(N)(=O)=O)cc(N)c1C.
What is the InChIKey of 3-amino-4,5-dimethylbenzenesulfonamide?
The InChIKey is YXQMLWCILAYJQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2S/c1-5-3-7(13(10,11)12)4-8(9)6(5)2/h3-4H,9H2,1-2H3,(H2,10,11,12).
What are the key properties of 3-amino-4,5-dimethylbenzenesulfonamide?
3-amino-4,5-dimethylbenzenesulfonamide has a molecular weight of 200.26 g/mol, XLogP of 0.53, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4,5-dimethylbenzenesulfonamide is sourced from PubChem (CID 4961879), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).