About 4-(2-bromoacetyl)-N,N-dimethylbenzenesulfonamide
4-(2-bromoacetyl)-N,N-dimethylbenzenesulfonamide (PubChem CID 4962123) has the molecular formula C10H12BrNO3S
and a molecular weight of 306.18 g/mol. Its IUPAC name is 4-(2-bromoacetyl)-N,N-dimethylbenzenesulfonamide.
Molecular Properties
| Compound Name | 4-(2-bromoacetyl)-N,N-dimethylbenzenesulfonamide |
| PubChem CID | 4962123 |
| Molecular Formula | C10H12BrNO3S |
| Molecular Weight | 306.18 g/mol |
| Exact Mass | 304.97 |
| IUPAC Name | 4-(2-bromoacetyl)-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)CBr)cc1 |
| InChI | InChI=1S/C10H12BrNO3S/c1-12(2)16(14,15)9-5-3-8(4-6-9)10(13)7-11/h3-6H,7H2,1-2H3 |
| InChIKey | GPRFNTIBFADUHF-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.18 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-bromoacetyl)-N,N-dimethylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-bromoacetyl)-N,N-dimethylbenzenesulfonamide?
The IUPAC name of 4-(2-bromoacetyl)-N,N-dimethylbenzenesulfonamide (CID 4962123) is 4-(2-bromoacetyl)-N,N-dimethylbenzenesulfonamide.
What is the SMILES notation for 4-(2-bromoacetyl)-N,N-dimethylbenzenesulfonamide?
The canonical SMILES for 4-(2-bromoacetyl)-N,N-dimethylbenzenesulfonamide is CN(C)S(=O)(=O)c1ccc(C(=O)CBr)cc1.
What is the InChIKey of 4-(2-bromoacetyl)-N,N-dimethylbenzenesulfonamide?
The InChIKey is GPRFNTIBFADUHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrNO3S/c1-12(2)16(14,15)9-5-3-8(4-6-9)10(13)7-11/h3-6H,7H2,1-2H3.
What are the key properties of 4-(2-bromoacetyl)-N,N-dimethylbenzenesulfonamide?
4-(2-bromoacetyl)-N,N-dimethylbenzenesulfonamide has a molecular weight of 306.18 g/mol, XLogP of 1.51, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-bromoacetyl)-N,N-dimethylbenzenesulfonamide is sourced from PubChem (CID 4962123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).