About N-ethyl-4-fluoroaniline
N-ethyl-4-fluoroaniline (PubChem CID 4962184) has the molecular formula C8H10FN
and a molecular weight of 139.17 g/mol. Its IUPAC name is N-ethyl-4-fluoroaniline.
Molecular Properties
| Compound Name | N-ethyl-4-fluoroaniline |
| PubChem CID | 4962184 |
| Molecular Formula | C8H10FN |
| Molecular Weight | 139.17 g/mol |
| Exact Mass | 139.08 |
| IUPAC Name | N-ethyl-4-fluoroaniline |
| SMILES | CCNc1ccc(F)cc1 |
| InChI | InChI=1S/C8H10FN/c1-2-10-8-5-3-7(9)4-6-8/h3-6,10H,2H2,1H3 |
| InChIKey | MBSPOYRKNIDVOA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.17 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-ethyl-4-fluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-4-fluoroaniline?
The IUPAC name of N-ethyl-4-fluoroaniline (CID 4962184) is N-ethyl-4-fluoroaniline.
What is the SMILES notation for N-ethyl-4-fluoroaniline?
The canonical SMILES for N-ethyl-4-fluoroaniline is CCNc1ccc(F)cc1.
What is the InChIKey of N-ethyl-4-fluoroaniline?
The InChIKey is MBSPOYRKNIDVOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10FN/c1-2-10-8-5-3-7(9)4-6-8/h3-6,10H,2H2,1H3.
What are the key properties of N-ethyl-4-fluoroaniline?
N-ethyl-4-fluoroaniline has a molecular weight of 139.17 g/mol, XLogP of 2.26, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-4-fluoroaniline is sourced from PubChem (CID 4962184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).