About 1-[4-(1,2,4-triazol-1-yl)phenyl]ethanamine
1-[4-(1,2,4-triazol-1-yl)phenyl]ethanamine (PubChem CID 4962205) has the molecular formula C10H12N4
and a molecular weight of 188.23 g/mol. Its IUPAC name is 1-[4-(1,2,4-triazol-1-yl)phenyl]ethanamine.
Molecular Properties
| Compound Name | 1-[4-(1,2,4-triazol-1-yl)phenyl]ethanamine |
| PubChem CID | 4962205 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 1-[4-(1,2,4-triazol-1-yl)phenyl]ethanamine |
| SMILES | CC(N)c1ccc(-n2cncn2)cc1 |
| InChI | InChI=1S/C10H12N4/c1-8(11)9-2-4-10(5-3-9)14-7-12-6-13-14/h2-8H,11H2,1H3 |
| InChIKey | LWCNLFHKRQJWOW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-(1,2,4-triazol-1-yl)phenyl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(1,2,4-triazol-1-yl)phenyl]ethanamine?
The IUPAC name of 1-[4-(1,2,4-triazol-1-yl)phenyl]ethanamine (CID 4962205) is 1-[4-(1,2,4-triazol-1-yl)phenyl]ethanamine.
What is the SMILES notation for 1-[4-(1,2,4-triazol-1-yl)phenyl]ethanamine?
The canonical SMILES for 1-[4-(1,2,4-triazol-1-yl)phenyl]ethanamine is CC(N)c1ccc(-n2cncn2)cc1.
What is the InChIKey of 1-[4-(1,2,4-triazol-1-yl)phenyl]ethanamine?
The InChIKey is LWCNLFHKRQJWOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4/c1-8(11)9-2-4-10(5-3-9)14-7-12-6-13-14/h2-8H,11H2,1H3.
What are the key properties of 1-[4-(1,2,4-triazol-1-yl)phenyl]ethanamine?
1-[4-(1,2,4-triazol-1-yl)phenyl]ethanamine has a molecular weight of 188.23 g/mol, XLogP of 1.29, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(1,2,4-triazol-1-yl)phenyl]ethanamine is sourced from PubChem (CID 4962205), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).