About 1-(2-chloroacetyl)-4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-one
1-(2-chloroacetyl)-4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-one (PubChem CID 4962266) has the molecular formula C10H10ClN3O2
and a molecular weight of 239.66 g/mol. Its IUPAC name is 1-(2-chloroacetyl)-4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-one.
Molecular Properties
| Compound Name | 1-(2-chloroacetyl)-4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-one |
| PubChem CID | 4962266 |
| Molecular Formula | C10H10ClN3O2 |
| Molecular Weight | 239.66 g/mol |
| Exact Mass | 239.05 |
| IUPAC Name | 1-(2-chloroacetyl)-4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-one |
| SMILES | Cc1cc(C)c2c(=O)[nH]n(C(=O)CCl)c2n1 |
| InChI | InChI=1S/C10H10ClN3O2/c1-5-3-6(2)12-9-8(5)10(16)13-14(9)7(15)4-11/h3H,4H2,1-2H3,(H,13,16) |
| InChIKey | CXZCOJJJQGZASR-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 67.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.66 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-chloroacetyl)-4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-chloroacetyl)-4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-one?
The IUPAC name of 1-(2-chloroacetyl)-4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-one (CID 4962266) is 1-(2-chloroacetyl)-4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-one.
What is the SMILES notation for 1-(2-chloroacetyl)-4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-one?
The canonical SMILES for 1-(2-chloroacetyl)-4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-one is Cc1cc(C)c2c(=O)[nH]n(C(=O)CCl)c2n1.
What is the InChIKey of 1-(2-chloroacetyl)-4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-one?
The InChIKey is CXZCOJJJQGZASR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10ClN3O2/c1-5-3-6(2)12-9-8(5)10(16)13-14(9)7(15)4-11/h3H,4H2,1-2H3,(H,13,16).
What are the key properties of 1-(2-chloroacetyl)-4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-one?
1-(2-chloroacetyl)-4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-one has a molecular weight of 239.66 g/mol, XLogP of 1.22, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-chloroacetyl)-4,6-dimethyl-2H-pyrazolo[3,4-b]pyridin-3-one is sourced from PubChem (CID 4962266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).