About N-cyclopropyl-1,1-dioxothiolan-3-amine
N-cyclopropyl-1,1-dioxothiolan-3-amine (PubChem CID 4962275) has the molecular formula C7H13NO2S
and a molecular weight of 175.25 g/mol. Its IUPAC name is N-cyclopropyl-1,1-dioxothiolan-3-amine.
Molecular Properties
| Compound Name | N-cyclopropyl-1,1-dioxothiolan-3-amine |
| PubChem CID | 4962275 |
| Molecular Formula | C7H13NO2S |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | N-cyclopropyl-1,1-dioxothiolan-3-amine |
| SMILES | O=S1(=O)CCC(NC2CC2)C1 |
| InChI | InChI=1S/C7H13NO2S/c9-11(10)4-3-7(5-11)8-6-1-2-6/h6-8H,1-5H2 |
| InChIKey | YPQGVNVOARBNNY-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclopropyl-1,1-dioxothiolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-1,1-dioxothiolan-3-amine?
The IUPAC name of N-cyclopropyl-1,1-dioxothiolan-3-amine (CID 4962275) is N-cyclopropyl-1,1-dioxothiolan-3-amine.
What is the SMILES notation for N-cyclopropyl-1,1-dioxothiolan-3-amine?
The canonical SMILES for N-cyclopropyl-1,1-dioxothiolan-3-amine is O=S1(=O)CCC(NC2CC2)C1.
What is the InChIKey of N-cyclopropyl-1,1-dioxothiolan-3-amine?
The InChIKey is YPQGVNVOARBNNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2S/c9-11(10)4-3-7(5-11)8-6-1-2-6/h6-8H,1-5H2.
What are the key properties of N-cyclopropyl-1,1-dioxothiolan-3-amine?
N-cyclopropyl-1,1-dioxothiolan-3-amine has a molecular weight of 175.25 g/mol, XLogP of -0.07, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-1,1-dioxothiolan-3-amine is sourced from PubChem (CID 4962275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).