About 2-thiophen-2-ylethylurea
2-thiophen-2-ylethylurea (PubChem CID 4962323) has the molecular formula C7H10N2OS
and a molecular weight of 170.24 g/mol. Its IUPAC name is 2-thiophen-2-ylethylurea.
Molecular Properties
| Compound Name | 2-thiophen-2-ylethylurea |
| PubChem CID | 4962323 |
| Molecular Formula | C7H10N2OS |
| Molecular Weight | 170.24 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 2-thiophen-2-ylethylurea |
| SMILES | NC(=O)NCCc1cccs1 |
| InChI | InChI=1S/C7H10N2OS/c8-7(10)9-4-3-6-2-1-5-11-6/h1-2,5H,3-4H2,(H3,8,9,10) |
| InChIKey | OPFZOWWTCYPZND-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.24 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-thiophen-2-ylethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thiophen-2-ylethylurea?
The IUPAC name of 2-thiophen-2-ylethylurea (CID 4962323) is 2-thiophen-2-ylethylurea.
What is the SMILES notation for 2-thiophen-2-ylethylurea?
The canonical SMILES for 2-thiophen-2-ylethylurea is NC(=O)NCCc1cccs1.
What is the InChIKey of 2-thiophen-2-ylethylurea?
The InChIKey is OPFZOWWTCYPZND-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2OS/c8-7(10)9-4-3-6-2-1-5-11-6/h1-2,5H,3-4H2,(H3,8,9,10).
What are the key properties of 2-thiophen-2-ylethylurea?
2-thiophen-2-ylethylurea has a molecular weight of 170.24 g/mol, XLogP of 0.96, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thiophen-2-ylethylurea is sourced from PubChem (CID 4962323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).