C14H13N3O4S — CID 4962335
2-amino-N-(2-methoxyphenyl)-1,3-benzoxazole-5-sulfonamide (PubChem CID 4962335) has the molecular formula C14H13N3O4S and a molecular weight of 319.34 g/mol. Its IUPAC name is 2-amino-N-(2-methoxyphenyl)-1,3-benzoxazole-5-sulfonamide.
| Compound Name | 2-amino-N-(2-methoxyphenyl)-1,3-benzoxazole-5-sulfonamide |
|---|---|
| PubChem CID | 4962335 |
| Molecular Formula | C14H13N3O4S |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | 2-amino-N-(2-methoxyphenyl)-1,3-benzoxazole-5-sulfonamide |
| SMILES | COc1ccccc1NS(=O)(=O)c1ccc2oc(N)nc2c1 |
| InChI | InChI=1S/C14H13N3O4S/c1-20-12-5-3-2-4-10(12)17-22(18,19)9-6-7-13-11(8-9)16-14(15)21-13/h2-8,17H,1H3,(H2,15,16) |
| InChIKey | HYIGKSKNTOEEFM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |