C8H11N3S — CID 4962443
3,4-dicyclopropyl-1H-1,2,4-triazole-5-thione (PubChem CID 4962443) has the molecular formula C8H11N3S and a molecular weight of 181.26 g/mol. Its IUPAC name is 3,4-dicyclopropyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3,4-dicyclopropyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 4962443 |
| Molecular Formula | C8H11N3S |
| Molecular Weight | 181.26 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 3,4-dicyclopropyl-1H-1,2,4-triazole-5-thione |
| SMILES | S=c1[nH]nc(C2CC2)n1C1CC1 |
| InChI | InChI=1S/C8H11N3S/c12-8-10-9-7(5-1-2-5)11(8)6-3-4-6/h5-6H,1-4H2,(H,10,12) |
| InChIKey | POEHKVJDADUKKD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 33.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|