About 2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanamine
2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanamine (PubChem CID 4962484) has the molecular formula C8H10N4
and a molecular weight of 162.20 g/mol. Its IUPAC name is 2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanamine.
Analyze 2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanamine?
The IUPAC name of 2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanamine (CID 4962484) is 2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanamine.
What is the SMILES notation for 2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanamine?
The canonical SMILES for 2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanamine is NCCc1nnc2ccccn12.
What is the InChIKey of 2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanamine?
The InChIKey is FKNUBXUNMZSEDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4/c9-5-4-8-11-10-7-3-1-2-6-12(7)8/h1-3,6H,4-5,9H2.
What are the key properties of 2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanamine?
2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanamine has a molecular weight of 162.20 g/mol, XLogP of 0.23, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethanamine is sourced from PubChem (CID 4962484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).