3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoic acid

C12H11NO4 — CID 4962537

IUPAC3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoic acid
SMILESO=C(O)CCN1C(=O)Cc2ccccc2C1=O
InChIInChI=1S/C12H11NO4/c14-10-7-8-3-1-2-4-9(8)12(17)13(10)6-5-11(15)16/h1-4H,5-7H2,(H,15,16)
InChIKeyORZUYKZVLRIJEB-UHFFFAOYSA-N
MW233.22 g/mol
LogP0.69
Rot. Bonds3

About 3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoic acid

3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoic acid (PubChem CID 4962537) has the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. Its IUPAC name is 3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoic acid.

Molecular Properties

Compound Name3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoic acid
PubChem CID4962537
Molecular FormulaC12H11NO4
Molecular Weight233.22 g/mol
Exact Mass233.07
IUPAC Name3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoic acid
SMILESO=C(O)CCN1C(=O)Cc2ccccc2C1=O
InChIInChI=1S/C12H11NO4/c14-10-7-8-3-1-2-4-9(8)12(17)13(10)6-5-11(15)16/h1-4H,5-7H2,(H,15,16)
InChIKeyORZUYKZVLRIJEB-UHFFFAOYSA-N
XLogP0.69
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.22
LogP ≤ 50.69
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoic acid?
The IUPAC name of 3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoic acid (CID 4962537) is 3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoic acid.
What is the SMILES notation for 3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoic acid?
The canonical SMILES for 3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoic acid is O=C(O)CCN1C(=O)Cc2ccccc2C1=O.
What is the InChIKey of 3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoic acid?
The InChIKey is ORZUYKZVLRIJEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO4/c14-10-7-8-3-1-2-4-9(8)12(17)13(10)6-5-11(15)16/h1-4H,5-7H2,(H,15,16).
What are the key properties of 3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoic acid?
3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoic acid has a molecular weight of 233.22 g/mol, XLogP of 0.69, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-dioxo-4H-isoquinolin-2-yl)propanoic acid is sourced from PubChem (CID 4962537), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).