2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid

C11H8ClNO2S — CID 4962559

IUPAC2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid
SMILESO=C(O)Cc1csc(-c2ccccc2Cl)n1
InChIInChI=1S/C11H8ClNO2S/c12-9-4-2-1-3-8(9)11-13-7(6-16-11)5-10(14)15/h1-4,6H,5H2,(H,14,15)
InChIKeyYHTKTBSWVKJNQG-UHFFFAOYSA-N
MW253.71 g/mol
LogP3.09
Rot. Bonds3

About 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid

2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid (PubChem CID 4962559) has the molecular formula C11H8ClNO2S and a molecular weight of 253.71 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid.

Molecular Properties

Compound Name2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid
PubChem CID4962559
Molecular FormulaC11H8ClNO2S
Molecular Weight253.71 g/mol
Exact Mass253.00
IUPAC Name2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid
SMILESO=C(O)Cc1csc(-c2ccccc2Cl)n1
InChIInChI=1S/C11H8ClNO2S/c12-9-4-2-1-3-8(9)11-13-7(6-16-11)5-10(14)15/h1-4,6H,5H2,(H,14,15)
InChIKeyYHTKTBSWVKJNQG-UHFFFAOYSA-N
XLogP3.09
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500253.71
LogP ≤ 53.09
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid?
The IUPAC name of 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid (CID 4962559) is 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid.
What is the SMILES notation for 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid?
The canonical SMILES for 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid is O=C(O)Cc1csc(-c2ccccc2Cl)n1.
What is the InChIKey of 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid?
The InChIKey is YHTKTBSWVKJNQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClNO2S/c12-9-4-2-1-3-8(9)11-13-7(6-16-11)5-10(14)15/h1-4,6H,5H2,(H,14,15).
What are the key properties of 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid?
2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid has a molecular weight of 253.71 g/mol, XLogP of 3.09, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetic acid is sourced from PubChem (CID 4962559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).