About 5-(propylamino)-3H-1,3,4-thiadiazole-2-thione
5-(propylamino)-3H-1,3,4-thiadiazole-2-thione (PubChem CID 4962618) has the molecular formula C5H9N3S2
and a molecular weight of 175.28 g/mol. Its IUPAC name is 5-(propylamino)-3H-1,3,4-thiadiazole-2-thione.
Molecular Properties
| Compound Name | 5-(propylamino)-3H-1,3,4-thiadiazole-2-thione |
| PubChem CID | 4962618 |
| Molecular Formula | C5H9N3S2 |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.02 |
| IUPAC Name | 5-(propylamino)-3H-1,3,4-thiadiazole-2-thione |
| SMILES | CCCNc1n[nH]c(=S)s1 |
| InChI | InChI=1S/C5H9N3S2/c1-2-3-6-4-7-8-5(9)10-4/h2-3H2,1H3,(H,6,7)(H,8,9) |
| InChIKey | NJQJHXZXNVNCMI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-(propylamino)-3H-1,3,4-thiadiazole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(propylamino)-3H-1,3,4-thiadiazole-2-thione?
The IUPAC name of 5-(propylamino)-3H-1,3,4-thiadiazole-2-thione (CID 4962618) is 5-(propylamino)-3H-1,3,4-thiadiazole-2-thione.
What is the SMILES notation for 5-(propylamino)-3H-1,3,4-thiadiazole-2-thione?
The canonical SMILES for 5-(propylamino)-3H-1,3,4-thiadiazole-2-thione is CCCNc1n[nH]c(=S)s1.
What is the InChIKey of 5-(propylamino)-3H-1,3,4-thiadiazole-2-thione?
The InChIKey is NJQJHXZXNVNCMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3S2/c1-2-3-6-4-7-8-5(9)10-4/h2-3H2,1H3,(H,6,7)(H,8,9).
What are the key properties of 5-(propylamino)-3H-1,3,4-thiadiazole-2-thione?
5-(propylamino)-3H-1,3,4-thiadiazole-2-thione has a molecular weight of 175.28 g/mol, XLogP of 2.02, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(propylamino)-3H-1,3,4-thiadiazole-2-thione is sourced from PubChem (CID 4962618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).