About 1-(3-bromopropoxy)-3,5-dimethylbenzene
1-(3-bromopropoxy)-3,5-dimethylbenzene (PubChem CID 4962698) has the molecular formula C11H15BrO
and a molecular weight of 243.14 g/mol. Its IUPAC name is 1-(3-bromopropoxy)-3,5-dimethylbenzene.
Molecular Properties
| Compound Name | 1-(3-bromopropoxy)-3,5-dimethylbenzene |
| PubChem CID | 4962698 |
| Molecular Formula | C11H15BrO |
| Molecular Weight | 243.14 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 1-(3-bromopropoxy)-3,5-dimethylbenzene |
| SMILES | Cc1cc(C)cc(OCCCBr)c1 |
| InChI | InChI=1S/C11H15BrO/c1-9-6-10(2)8-11(7-9)13-5-3-4-12/h6-8H,3-5H2,1-2H3 |
| InChIKey | FGTRKEKWAVDNIK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.14 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-bromopropoxy)-3,5-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-bromopropoxy)-3,5-dimethylbenzene?
The IUPAC name of 1-(3-bromopropoxy)-3,5-dimethylbenzene (CID 4962698) is 1-(3-bromopropoxy)-3,5-dimethylbenzene.
What is the SMILES notation for 1-(3-bromopropoxy)-3,5-dimethylbenzene?
The canonical SMILES for 1-(3-bromopropoxy)-3,5-dimethylbenzene is Cc1cc(C)cc(OCCCBr)c1.
What is the InChIKey of 1-(3-bromopropoxy)-3,5-dimethylbenzene?
The InChIKey is FGTRKEKWAVDNIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15BrO/c1-9-6-10(2)8-11(7-9)13-5-3-4-12/h6-8H,3-5H2,1-2H3.
What are the key properties of 1-(3-bromopropoxy)-3,5-dimethylbenzene?
1-(3-bromopropoxy)-3,5-dimethylbenzene has a molecular weight of 243.14 g/mol, XLogP of 3.47, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-bromopropoxy)-3,5-dimethylbenzene is sourced from PubChem (CID 4962698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).