C10H16N2O2S — CID 4962713
3-amino-N,N,4,5-tetramethylbenzenesulfonamide (PubChem CID 4962713) has the molecular formula C10H16N2O2S and a molecular weight of 228.32 g/mol. Its IUPAC name is 3-amino-N,N,4,5-tetramethylbenzenesulfonamide.
| Compound Name | 3-amino-N,N,4,5-tetramethylbenzenesulfonamide |
|---|---|
| PubChem CID | 4962713 |
| Molecular Formula | C10H16N2O2S |
| Molecular Weight | 228.32 g/mol |
| Exact Mass | 228.09 |
| IUPAC Name | 3-amino-N,N,4,5-tetramethylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N(C)C)cc(N)c1C |
| InChI | InChI=1S/C10H16N2O2S/c1-7-5-9(6-10(11)8(7)2)15(13,14)12(3)4/h5-6H,11H2,1-4H3 |
| InChIKey | ACLGQJHSMVTHFR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|