C11H13N5O — CID 4962893
3,4-diamino-6-(2-phenylethyl)-1,2,4-triazin-5-one (PubChem CID 4962893) has the molecular formula C11H13N5O and a molecular weight of 231.26 g/mol. Its IUPAC name is 3,4-diamino-6-(2-phenylethyl)-1,2,4-triazin-5-one.
| Compound Name | 3,4-diamino-6-(2-phenylethyl)-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 4962893 |
| Molecular Formula | C11H13N5O |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 3,4-diamino-6-(2-phenylethyl)-1,2,4-triazin-5-one |
| SMILES | Nc1nnc(CCc2ccccc2)c(=O)n1N |
| InChI | InChI=1S/C11H13N5O/c12-11-15-14-9(10(17)16(11)13)7-6-8-4-2-1-3-5-8/h1-5H,6-7,13H2,(H2,12,15) |
| InChIKey | ZINFLYVMNNCCAM-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 99.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |