C22H20N3S+ — CID 4963180
N,N-dimethyl-4-[2-(3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-4-ium-7-yl)ethenyl]aniline (PubChem CID 4963180) has the molecular formula C22H20N3S+ and a molecular weight of 358.49 g/mol. Its IUPAC name is N,N-dimethyl-4-[2-(3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-4-ium-7-yl)ethenyl]aniline.
| Compound Name | N,N-dimethyl-4-[2-(3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-4-ium-7-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 4963180 |
| Molecular Formula | C22H20N3S+ |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | N,N-dimethyl-4-[2-(3-phenyl-[1,3]thiazolo[3,2-a]pyrimidin-4-ium-7-yl)ethenyl]aniline |
| SMILES | CN(C)c1ccc(C=Cc2cc[n+]3c(-c4ccccc4)csc3n2)cc1 |
| InChI | InChI=1S/C22H20N3S/c1-24(2)20-12-9-17(10-13-20)8-11-19-14-15-25-21(16-26-22(25)23-19)18-6-4-3-5-7-18/h3-16H,1-2H3/q+1 |
| InChIKey | OZVGXMPNXAXUOB-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|