About 2-(benzenesulfonyl)-3-(3,4-dimethoxyphenyl)-5-(4-methylphenyl)-3,4-dihydropyrazole
2-(benzenesulfonyl)-3-(3,4-dimethoxyphenyl)-5-(4-methylphenyl)-3,4-dihydropyrazole (PubChem CID 4963246) has the molecular formula C24H24N2O4S
and a molecular weight of 436.53 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-3-(3,4-dimethoxyphenyl)-5-(4-methylphenyl)-3,4-dihydropyrazole.
Molecular Properties
| Compound Name | 2-(benzenesulfonyl)-3-(3,4-dimethoxyphenyl)-5-(4-methylphenyl)-3,4-dihydropyrazole |
| PubChem CID | 4963246 |
| Molecular Formula | C24H24N2O4S |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.15 |
| IUPAC Name | 2-(benzenesulfonyl)-3-(3,4-dimethoxyphenyl)-5-(4-methylphenyl)-3,4-dihydropyrazole |
| SMILES | COc1ccc(C2CC(c3ccc(C)cc3)=NN2S(=O)(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C24H24N2O4S/c1-17-9-11-18(12-10-17)21-16-22(19-13-14-23(29-2)24(15-19)30-3)26(25-21)31(27,28)20-7-5-4-6-8-20/h4-15,22H,16H2,1-3H3 |
| InChIKey | SQNRCCZRAYYJRF-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(benzenesulfonyl)-3-(3,4-dimethoxyphenyl)-5-(4-methylphenyl)-3,4-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzenesulfonyl)-3-(3,4-dimethoxyphenyl)-5-(4-methylphenyl)-3,4-dihydropyrazole?
The IUPAC name of 2-(benzenesulfonyl)-3-(3,4-dimethoxyphenyl)-5-(4-methylphenyl)-3,4-dihydropyrazole (CID 4963246) is 2-(benzenesulfonyl)-3-(3,4-dimethoxyphenyl)-5-(4-methylphenyl)-3,4-dihydropyrazole.
What is the SMILES notation for 2-(benzenesulfonyl)-3-(3,4-dimethoxyphenyl)-5-(4-methylphenyl)-3,4-dihydropyrazole?
The canonical SMILES for 2-(benzenesulfonyl)-3-(3,4-dimethoxyphenyl)-5-(4-methylphenyl)-3,4-dihydropyrazole is COc1ccc(C2CC(c3ccc(C)cc3)=NN2S(=O)(=O)c2ccccc2)cc1OC.
What is the InChIKey of 2-(benzenesulfonyl)-3-(3,4-dimethoxyphenyl)-5-(4-methylphenyl)-3,4-dihydropyrazole?
The InChIKey is SQNRCCZRAYYJRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24N2O4S/c1-17-9-11-18(12-10-17)21-16-22(19-13-14-23(29-2)24(15-19)30-3)26(25-21)31(27,28)20-7-5-4-6-8-20/h4-15,22H,16H2,1-3H3.
What are the key properties of 2-(benzenesulfonyl)-3-(3,4-dimethoxyphenyl)-5-(4-methylphenyl)-3,4-dihydropyrazole?
2-(benzenesulfonyl)-3-(3,4-dimethoxyphenyl)-5-(4-methylphenyl)-3,4-dihydropyrazole has a molecular weight of 436.53 g/mol, XLogP of 4.55, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzenesulfonyl)-3-(3,4-dimethoxyphenyl)-5-(4-methylphenyl)-3,4-dihydropyrazole is sourced from PubChem (CID 4963246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).