About [2-(4-fluoroanilino)-2-oxoethyl] 2-(2-oxo-5-phenyl-1,3,4-oxadiazol-3-yl)acetate
[2-(4-fluoroanilino)-2-oxoethyl] 2-(2-oxo-5-phenyl-1,3,4-oxadiazol-3-yl)acetate (PubChem CID 4963490) has the molecular formula C18H14FN3O5
and a molecular weight of 371.32 g/mol. Its IUPAC name is [2-(4-fluoroanilino)-2-oxoethyl] 2-(2-oxo-5-phenyl-1,3,4-oxadiazol-3-yl)acetate.
Molecular Properties
| Compound Name | [2-(4-fluoroanilino)-2-oxoethyl] 2-(2-oxo-5-phenyl-1,3,4-oxadiazol-3-yl)acetate |
| PubChem CID | 4963490 |
| Molecular Formula | C18H14FN3O5 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | [2-(4-fluoroanilino)-2-oxoethyl] 2-(2-oxo-5-phenyl-1,3,4-oxadiazol-3-yl)acetate |
| SMILES | O=C(COC(=O)Cn1nc(-c2ccccc2)oc1=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C18H14FN3O5/c19-13-6-8-14(9-7-13)20-15(23)11-26-16(24)10-22-18(25)27-17(21-22)12-4-2-1-3-5-12/h1-9H,10-11H2,(H,20,23) |
| InChIKey | GDDQSHXCXMDOQR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [2-(4-fluoroanilino)-2-oxoethyl] 2-(2-oxo-5-phenyl-1,3,4-oxadiazol-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(4-fluoroanilino)-2-oxoethyl] 2-(2-oxo-5-phenyl-1,3,4-oxadiazol-3-yl)acetate?
The IUPAC name of [2-(4-fluoroanilino)-2-oxoethyl] 2-(2-oxo-5-phenyl-1,3,4-oxadiazol-3-yl)acetate (CID 4963490) is [2-(4-fluoroanilino)-2-oxoethyl] 2-(2-oxo-5-phenyl-1,3,4-oxadiazol-3-yl)acetate.
What is the SMILES notation for [2-(4-fluoroanilino)-2-oxoethyl] 2-(2-oxo-5-phenyl-1,3,4-oxadiazol-3-yl)acetate?
The canonical SMILES for [2-(4-fluoroanilino)-2-oxoethyl] 2-(2-oxo-5-phenyl-1,3,4-oxadiazol-3-yl)acetate is O=C(COC(=O)Cn1nc(-c2ccccc2)oc1=O)Nc1ccc(F)cc1.
What is the InChIKey of [2-(4-fluoroanilino)-2-oxoethyl] 2-(2-oxo-5-phenyl-1,3,4-oxadiazol-3-yl)acetate?
The InChIKey is GDDQSHXCXMDOQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14FN3O5/c19-13-6-8-14(9-7-13)20-15(23)11-26-16(24)10-22-18(25)27-17(21-22)12-4-2-1-3-5-12/h1-9H,10-11H2,(H,20,23).
What are the key properties of [2-(4-fluoroanilino)-2-oxoethyl] 2-(2-oxo-5-phenyl-1,3,4-oxadiazol-3-yl)acetate?
[2-(4-fluoroanilino)-2-oxoethyl] 2-(2-oxo-5-phenyl-1,3,4-oxadiazol-3-yl)acetate has a molecular weight of 371.32 g/mol, XLogP of 1.82, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(4-fluoroanilino)-2-oxoethyl] 2-(2-oxo-5-phenyl-1,3,4-oxadiazol-3-yl)acetate is sourced from PubChem (CID 4963490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).