C24H15FN2O4S — CID 4963496
8-acetyl-7-[5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]oxy-4-methylchromen-2-one (PubChem CID 4963496) has the molecular formula C24H15FN2O4S and a molecular weight of 446.46 g/mol. Its IUPAC name is 8-acetyl-7-[5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]oxy-4-methylchromen-2-one.
| Compound Name | 8-acetyl-7-[5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]oxy-4-methylchromen-2-one |
|---|---|
| PubChem CID | 4963496 |
| Molecular Formula | C24H15FN2O4S |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 8-acetyl-7-[5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-yl]oxy-4-methylchromen-2-one |
| SMILES | CC(=O)c1c(Oc2ncnc3scc(-c4ccc(F)cc4)c23)ccc2c(C)cc(=O)oc12 |
| InChI | InChI=1S/C24H15FN2O4S/c1-12-9-19(29)31-22-16(12)7-8-18(20(22)13(2)28)30-23-21-17(10-32-24(21)27-11-26-23)14-3-5-15(25)6-4-14/h3-11H,1-2H3 |
| InChIKey | LGOUUDURLSYCGR-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|