About 2-(3-nitrophenyl)-1,3-dithiane
2-(3-nitrophenyl)-1,3-dithiane (PubChem CID 4963668) has the molecular formula C10H11NO2S2
and a molecular weight of 241.34 g/mol. Its IUPAC name is 2-(3-nitrophenyl)-1,3-dithiane.
Molecular Properties
| Compound Name | 2-(3-nitrophenyl)-1,3-dithiane |
| PubChem CID | 4963668 |
| Molecular Formula | C10H11NO2S2 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.02 |
| IUPAC Name | 2-(3-nitrophenyl)-1,3-dithiane |
| SMILES | O=[N+]([O-])c1cccc(C2SCCCS2)c1 |
| InChI | InChI=1S/C10H11NO2S2/c12-11(13)9-4-1-3-8(7-9)10-14-5-2-6-15-10/h1,3-4,7,10H,2,5-6H2 |
| InChIKey | SOQLUIIXIBGXGG-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-nitrophenyl)-1,3-dithiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-nitrophenyl)-1,3-dithiane?
The IUPAC name of 2-(3-nitrophenyl)-1,3-dithiane (CID 4963668) is 2-(3-nitrophenyl)-1,3-dithiane.
What is the SMILES notation for 2-(3-nitrophenyl)-1,3-dithiane?
The canonical SMILES for 2-(3-nitrophenyl)-1,3-dithiane is O=[N+]([O-])c1cccc(C2SCCCS2)c1.
What is the InChIKey of 2-(3-nitrophenyl)-1,3-dithiane?
The InChIKey is SOQLUIIXIBGXGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2S2/c12-11(13)9-4-1-3-8(7-9)10-14-5-2-6-15-10/h1,3-4,7,10H,2,5-6H2.
What are the key properties of 2-(3-nitrophenyl)-1,3-dithiane?
2-(3-nitrophenyl)-1,3-dithiane has a molecular weight of 241.34 g/mol, XLogP of 3.46, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-nitrophenyl)-1,3-dithiane is sourced from PubChem (CID 4963668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).