C13H12F2N4OS — CID 4964024
6-[4-(difluoromethoxy)phenyl]-3,7-dimethyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine (PubChem CID 4964024) has the molecular formula C13H12F2N4OS and a molecular weight of 310.33 g/mol. Its IUPAC name is 6-[4-(difluoromethoxy)phenyl]-3,7-dimethyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine.
| Compound Name | 6-[4-(difluoromethoxy)phenyl]-3,7-dimethyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
|---|---|
| PubChem CID | 4964024 |
| Molecular Formula | C13H12F2N4OS |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | 6-[4-(difluoromethoxy)phenyl]-3,7-dimethyl-7H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
| SMILES | Cc1nnc2n1N=C(c1ccc(OC(F)F)cc1)C(C)S2 |
| InChI | InChI=1S/C13H12F2N4OS/c1-7-11(18-19-8(2)16-17-13(19)21-7)9-3-5-10(6-4-9)20-12(14)15/h3-7,12H,1-2H3 |
| InChIKey | JIPKHGRUKWPLCO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 52.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |