About N-(1,1-dioxothiolan-3-yl)-N,3-dimethylthiophene-2-carboxamide
N-(1,1-dioxothiolan-3-yl)-N,3-dimethylthiophene-2-carboxamide (PubChem CID 4964210) has the molecular formula C11H15NO3S2
and a molecular weight of 273.38 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N,3-dimethylthiophene-2-carboxamide.
Molecular Properties
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N,3-dimethylthiophene-2-carboxamide |
| PubChem CID | 4964210 |
| Molecular Formula | C11H15NO3S2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N,3-dimethylthiophene-2-carboxamide |
| SMILES | Cc1ccsc1C(=O)N(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C11H15NO3S2/c1-8-3-5-16-10(8)11(13)12(2)9-4-6-17(14,15)7-9/h3,5,9H,4,6-7H2,1-2H3 |
| InChIKey | SELSQCWJRJUADA-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1,1-dioxothiolan-3-yl)-N,3-dimethylthiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,1-dioxothiolan-3-yl)-N,3-dimethylthiophene-2-carboxamide?
The IUPAC name of N-(1,1-dioxothiolan-3-yl)-N,3-dimethylthiophene-2-carboxamide (CID 4964210) is N-(1,1-dioxothiolan-3-yl)-N,3-dimethylthiophene-2-carboxamide.
What is the SMILES notation for N-(1,1-dioxothiolan-3-yl)-N,3-dimethylthiophene-2-carboxamide?
The canonical SMILES for N-(1,1-dioxothiolan-3-yl)-N,3-dimethylthiophene-2-carboxamide is Cc1ccsc1C(=O)N(C)C1CCS(=O)(=O)C1.
What is the InChIKey of N-(1,1-dioxothiolan-3-yl)-N,3-dimethylthiophene-2-carboxamide?
The InChIKey is SELSQCWJRJUADA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO3S2/c1-8-3-5-16-10(8)11(13)12(2)9-4-6-17(14,15)7-9/h3,5,9H,4,6-7H2,1-2H3.
What are the key properties of N-(1,1-dioxothiolan-3-yl)-N,3-dimethylthiophene-2-carboxamide?
N-(1,1-dioxothiolan-3-yl)-N,3-dimethylthiophene-2-carboxamide has a molecular weight of 273.38 g/mol, XLogP of 1.32, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,1-dioxothiolan-3-yl)-N,3-dimethylthiophene-2-carboxamide is sourced from PubChem (CID 4964210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).