About [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 4-tert-butylbenzoate
[2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 4-tert-butylbenzoate (PubChem CID 4964229) has the molecular formula C22H24N2O3
and a molecular weight of 364.45 g/mol. Its IUPAC name is [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 4-tert-butylbenzoate.
Molecular Properties
| Compound Name | [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 4-tert-butylbenzoate |
| PubChem CID | 4964229 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 4-tert-butylbenzoate |
| SMILES | CC(C)(C)c1ccc(C(=O)OCC(=O)N2CCC(c3ccccc3)=N2)cc1 |
| InChI | InChI=1S/C22H24N2O3/c1-22(2,3)18-11-9-17(10-12-18)21(26)27-15-20(25)24-14-13-19(23-24)16-7-5-4-6-8-16/h4-12H,13-15H2,1-3H3 |
| InChIKey | WPNDNKXVWAQTJO-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 4-tert-butylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 4-tert-butylbenzoate?
The IUPAC name of [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 4-tert-butylbenzoate (CID 4964229) is [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 4-tert-butylbenzoate.
What is the SMILES notation for [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 4-tert-butylbenzoate?
The canonical SMILES for [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 4-tert-butylbenzoate is CC(C)(C)c1ccc(C(=O)OCC(=O)N2CCC(c3ccccc3)=N2)cc1.
What is the InChIKey of [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 4-tert-butylbenzoate?
The InChIKey is WPNDNKXVWAQTJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H24N2O3/c1-22(2,3)18-11-9-17(10-12-18)21(26)27-15-20(25)24-14-13-19(23-24)16-7-5-4-6-8-16/h4-12H,13-15H2,1-3H3.
What are the key properties of [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 4-tert-butylbenzoate?
[2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 4-tert-butylbenzoate has a molecular weight of 364.45 g/mol, XLogP of 3.78, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(5-phenyl-3,4-dihydropyrazol-2-yl)ethyl] 4-tert-butylbenzoate is sourced from PubChem (CID 4964229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).