C20H29N3O7 — CID 4964987
N-[2-[4-(4-acetylpiperazin-1-yl)phenoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide (PubChem CID 4964987) has the molecular formula C20H29N3O7 and a molecular weight of 423.47 g/mol. Its IUPAC name is N-[2-[4-(4-acetylpiperazin-1-yl)phenoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide.
| Compound Name | N-[2-[4-(4-acetylpiperazin-1-yl)phenoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
|---|---|
| PubChem CID | 4964987 |
| Molecular Formula | C20H29N3O7 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | N-[2-[4-(4-acetylpiperazin-1-yl)phenoxy]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]acetamide |
| SMILES | CC(=O)NC1C(Oc2ccc(N3CCN(C(C)=O)CC3)cc2)OC(CO)C(O)C1O |
| InChI | InChI=1S/C20H29N3O7/c1-12(25)21-17-19(28)18(27)16(11-24)30-20(17)29-15-5-3-14(4-6-15)23-9-7-22(8-10-23)13(2)26/h3-6,16-20,24,27-28H,7-11H2,1-2H3,(H,21,25) |
| InChIKey | SEISZVSTYTWRRF-UHFFFAOYSA-N |
| XLogP | -1.32 |
| TPSA | 131.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|