C18H17F3N4O2S — CID 4965145
2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl-propylamino]-N-(2,3,4-trifluorophenyl)acetamide (PubChem CID 4965145) has the molecular formula C18H17F3N4O2S and a molecular weight of 410.42 g/mol. Its IUPAC name is 2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl-propylamino]-N-(2,3,4-trifluorophenyl)acetamide.
| Compound Name | 2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl-propylamino]-N-(2,3,4-trifluorophenyl)acetamide |
|---|---|
| PubChem CID | 4965145 |
| Molecular Formula | C18H17F3N4O2S |
| Molecular Weight | 410.42 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 2-[(5-oxo-[1,3]thiazolo[3,2-a]pyrimidin-7-yl)methyl-propylamino]-N-(2,3,4-trifluorophenyl)acetamide |
| SMILES | CCCN(CC(=O)Nc1ccc(F)c(F)c1F)Cc1cc(=O)n2ccsc2n1 |
| InChI | InChI=1S/C18H17F3N4O2S/c1-2-5-24(9-11-8-15(27)25-6-7-28-18(25)22-11)10-14(26)23-13-4-3-12(19)16(20)17(13)21/h3-4,6-8H,2,5,9-10H2,1H3,(H,23,26) |
| InChIKey | CEOKNDYHGAUBCY-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|