C22H34N2O3 — CID 4965888
1-[3-[(5,8a-dimethyl-2-oxo-3,3a,4,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-3-yl)methylamino]propyl]pyrrolidin-2-one (PubChem CID 4965888) has the molecular formula C22H34N2O3 and a molecular weight of 374.53 g/mol. Its IUPAC name is 1-[3-[(5,8a-dimethyl-2-oxo-3,3a,4,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-3-yl)methylamino]propyl]pyrrolidin-2-one.
| Compound Name | 1-[3-[(5,8a-dimethyl-2-oxo-3,3a,4,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-3-yl)methylamino]propyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 4965888 |
| Molecular Formula | C22H34N2O3 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | 1-[3-[(5,8a-dimethyl-2-oxo-3,3a,4,6,7,8,9,9a-octahydrobenzo[f][1]benzofuran-3-yl)methylamino]propyl]pyrrolidin-2-one |
| SMILES | CC1=C2CC3C(CC2(C)CCC1)OC(=O)C3CNCCCN1CCCC1=O |
| InChI | InChI=1S/C22H34N2O3/c1-15-6-3-8-22(2)13-19-16(12-18(15)22)17(21(26)27-19)14-23-9-5-11-24-10-4-7-20(24)25/h16-17,19,23H,3-14H2,1-2H3 |
| InChIKey | WCJBZXQHZPQJFO-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|