C25H32N2O4 — CID 4965984
N-(2,2,6,6-tetramethylpiperidin-4-yl)-2-(2,3,5-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetamide (PubChem CID 4965984) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is N-(2,2,6,6-tetramethylpiperidin-4-yl)-2-(2,3,5-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetamide.
| Compound Name | N-(2,2,6,6-tetramethylpiperidin-4-yl)-2-(2,3,5-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetamide |
|---|---|
| PubChem CID | 4965984 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | N-(2,2,6,6-tetramethylpiperidin-4-yl)-2-(2,3,5-trimethyl-7-oxofuro[3,2-g]chromen-6-yl)acetamide |
| SMILES | Cc1oc2cc3oc(=O)c(CC(=O)NC4CC(C)(C)NC(C)(C)C4)c(C)c3cc2c1C |
| InChI | InChI=1S/C25H32N2O4/c1-13-15(3)30-20-10-21-18(8-17(13)20)14(2)19(23(29)31-21)9-22(28)26-16-11-24(4,5)27-25(6,7)12-16/h8,10,16,27H,9,11-12H2,1-7H3,(H,26,28) |
| InChIKey | OAVPZLNCWSMFLU-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|