C14H19ClN4O4S — CID 4966182
N-[4-chloro-3-(dimethylsulfamoyl)phenyl]-2-(3-oxopiperazin-1-yl)acetamide (PubChem CID 4966182) has the molecular formula C14H19ClN4O4S and a molecular weight of 374.85 g/mol. Its IUPAC name is N-[4-chloro-3-(dimethylsulfamoyl)phenyl]-2-(3-oxopiperazin-1-yl)acetamide.
| Compound Name | N-[4-chloro-3-(dimethylsulfamoyl)phenyl]-2-(3-oxopiperazin-1-yl)acetamide |
|---|---|
| PubChem CID | 4966182 |
| Molecular Formula | C14H19ClN4O4S |
| Molecular Weight | 374.85 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | N-[4-chloro-3-(dimethylsulfamoyl)phenyl]-2-(3-oxopiperazin-1-yl)acetamide |
| SMILES | CN(C)S(=O)(=O)c1cc(NC(=O)CN2CCNC(=O)C2)ccc1Cl |
| InChI | InChI=1S/C14H19ClN4O4S/c1-18(2)24(22,23)12-7-10(3-4-11(12)15)17-14(21)9-19-6-5-16-13(20)8-19/h3-4,7H,5-6,8-9H2,1-2H3,(H,16,20)(H,17,21) |
| InChIKey | ZKFJMNRZMDXPRL-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.85 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |