C20H24N2O6S2 — CID 4966347
3-(benzenesulfonyl)-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)propanamide (PubChem CID 4966347) has the molecular formula C20H24N2O6S2 and a molecular weight of 452.55 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)propanamide.
| Compound Name | 3-(benzenesulfonyl)-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 4966347 |
| Molecular Formula | C20H24N2O6S2 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 3-(benzenesulfonyl)-N-(4-methyl-3-morpholin-4-ylsulfonylphenyl)propanamide |
| SMILES | Cc1ccc(NC(=O)CCS(=O)(=O)c2ccccc2)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C20H24N2O6S2/c1-16-7-8-17(15-19(16)30(26,27)22-10-12-28-13-11-22)21-20(23)9-14-29(24,25)18-5-3-2-4-6-18/h2-8,15H,9-14H2,1H3,(H,21,23) |
| InChIKey | WTHIITVRUBNWHH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |