About CID 4966698
CID 4966698 (PubChem CID 4966698) has the molecular formula C28H25N3O4
and a molecular weight of 467.53 g/mol.
Molecular Properties
| Compound Name | CID 4966698 |
| PubChem CID | 4966698 |
| Molecular Formula | C28H25N3O4 |
| Molecular Weight | 467.53 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | — |
| SMILES | CCc1ccc2c(c1)C1(C(=O)N2)N2CCCC2C(C(=O)c2ccco2)C12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C28H25N3O4/c1-2-16-11-12-20-18(15-16)28(26(34)30-20)27(17-7-3-4-8-19(17)29-25(27)33)23(21-9-5-13-31(21)28)24(32)22-10-6-14-35-22/h3-4,6-8,10-12,14-15,21,23H,2,5,9,13H2,1H3,(H,29,33)(H,30,34) |
| InChIKey | QGQQSQTZVVSZHK-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 467.53 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze CID 4966698 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 4966698?
The IUPAC name of CID 4966698 (CID 4966698) is not available.
What is the SMILES notation for CID 4966698?
The canonical SMILES for CID 4966698 is CCc1ccc2c(c1)C1(C(=O)N2)N2CCCC2C(C(=O)c2ccco2)C12C(=O)Nc1ccccc12.
What is the InChIKey of CID 4966698?
The InChIKey is QGQQSQTZVVSZHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H25N3O4/c1-2-16-11-12-20-18(15-16)28(26(34)30-20)27(17-7-3-4-8-19(17)29-25(27)33)23(21-9-5-13-31(21)28)24(32)22-10-6-14-35-22/h3-4,6-8,10-12,14-15,21,23H,2,5,9,13H2,1H3,(H,29,33)(H,30,34).
What are the key properties of CID 4966698?
CID 4966698 has a molecular weight of 467.53 g/mol, XLogP of 3.86, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 4966698 is sourced from PubChem (CID 4966698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).