C23H40N2O3 — CID 4966738
5-[[2-[di(propan-2-yl)amino]ethylamino]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one (PubChem CID 4966738) has the molecular formula C23H40N2O3 and a molecular weight of 392.58 g/mol. Its IUPAC name is 5-[[2-[di(propan-2-yl)amino]ethylamino]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one.
| Compound Name | 5-[[2-[di(propan-2-yl)amino]ethylamino]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one |
|---|---|
| PubChem CID | 4966738 |
| Molecular Formula | C23H40N2O3 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.30 |
| IUPAC Name | 5-[[2-[di(propan-2-yl)amino]ethylamino]methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one |
| SMILES | CC(C)N(CCNCC1C(=O)OC2CC3(C)CCCC(C)C34OC4C21)C(C)C |
| InChI | InChI=1S/C23H40N2O3/c1-14(2)25(15(3)4)11-10-24-13-17-19-18(27-21(17)26)12-22(6)9-7-8-16(5)23(22)20(19)28-23/h14-20,24H,7-13H2,1-6H3 |
| InChIKey | BAWYVCHOXLPQRG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 54.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|