C19H31NO3 — CID 4967051
5-[(butan-2-ylamino)methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one (PubChem CID 4967051) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is 5-[(butan-2-ylamino)methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one.
| Compound Name | 5-[(butan-2-ylamino)methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one |
|---|---|
| PubChem CID | 4967051 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | 5-[(butan-2-ylamino)methyl]-10,14-dimethyl-2,7-dioxatetracyclo[8.4.0.01,3.04,8]tetradecan-6-one |
| SMILES | CCC(C)NCC1C(=O)OC2CC3(C)CCCC(C)C34OC4C21 |
| InChI | InChI=1S/C19H31NO3/c1-5-12(3)20-10-13-15-14(22-17(13)21)9-18(4)8-6-7-11(2)19(18)16(15)23-19/h11-16,20H,5-10H2,1-4H3 |
| InChIKey | QQOHIBRPUDOXBX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 50.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|