C16H19N3O4 — CID 4967330
2-[2-[(1,5-dimethylindole-2-carbonyl)amino]propanoylamino]acetic acid (PubChem CID 4967330) has the molecular formula C16H19N3O4 and a molecular weight of 317.35 g/mol. Its IUPAC name is 2-[2-[(1,5-dimethylindole-2-carbonyl)amino]propanoylamino]acetic acid.
| Compound Name | 2-[2-[(1,5-dimethylindole-2-carbonyl)amino]propanoylamino]acetic acid |
|---|---|
| PubChem CID | 4967330 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 2-[2-[(1,5-dimethylindole-2-carbonyl)amino]propanoylamino]acetic acid |
| SMILES | Cc1ccc2c(c1)cc(C(=O)NC(C)C(=O)NCC(=O)O)n2C |
| InChI | InChI=1S/C16H19N3O4/c1-9-4-5-12-11(6-9)7-13(19(12)3)16(23)18-10(2)15(22)17-8-14(20)21/h4-7,10H,8H2,1-3H3,(H,17,22)(H,18,23)(H,20,21) |
| InChIKey | ZPZPWAHCRURRQD-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |