C27H31NO8 — CID 4967518
2-[[7-acetamido-2-phenyl-6-(2-prop-2-enylphenoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]propanoic acid (PubChem CID 4967518) has the molecular formula C27H31NO8 and a molecular weight of 497.54 g/mol. Its IUPAC name is 2-[[7-acetamido-2-phenyl-6-(2-prop-2-enylphenoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]propanoic acid.
| Compound Name | 2-[[7-acetamido-2-phenyl-6-(2-prop-2-enylphenoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]propanoic acid |
|---|---|
| PubChem CID | 4967518 |
| Molecular Formula | C27H31NO8 |
| Molecular Weight | 497.54 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | 2-[[7-acetamido-2-phenyl-6-(2-prop-2-enylphenoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy]propanoic acid |
| SMILES | C=CCc1ccccc1OC1OC2COC(c3ccccc3)OC2C(OC(C)C(=O)O)C1NC(C)=O |
| InChI | InChI=1S/C27H31NO8/c1-4-10-18-11-8-9-14-20(18)34-27-22(28-17(3)29)24(33-16(2)25(30)31)23-21(35-27)15-32-26(36-23)19-12-6-5-7-13-19/h4-9,11-14,16,21-24,26-27H,1,10,15H2,2-3H3,(H,28,29)(H,30,31) |
| InChIKey | XIRIOEZOHQXKRW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.54 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|