C23H28N2O2S — CID 4967619
11-[3-(5-butylthiophen-2-yl)but-2-enoyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 4967619) has the molecular formula C23H28N2O2S and a molecular weight of 396.56 g/mol. Its IUPAC name is 11-[3-(5-butylthiophen-2-yl)but-2-enoyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | 11-[3-(5-butylthiophen-2-yl)but-2-enoyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 4967619 |
| Molecular Formula | C23H28N2O2S |
| Molecular Weight | 396.56 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 11-[3-(5-butylthiophen-2-yl)but-2-enoyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | CCCCc1ccc(C(C)=CC(=O)N2CC3CC(C2)c2cccc(=O)n2C3)s1 |
| InChI | InChI=1S/C23H28N2O2S/c1-3-4-6-19-9-10-21(28-19)16(2)11-23(27)24-13-17-12-18(15-24)20-7-5-8-22(26)25(20)14-17/h5,7-11,17-18H,3-4,6,12-15H2,1-2H3 |
| InChIKey | SBTLYDQQQBCMPR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.56 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|