C19H18BrN3O3S — CID 4967809
[[2-(6-bromo-4H-1,3-benzodioxin-8-yl)-7-methyl-2,3-dihydrochromen-4-ylidene]amino]thiourea (PubChem CID 4967809) has the molecular formula C19H18BrN3O3S and a molecular weight of 448.34 g/mol. Its IUPAC name is [[2-(6-bromo-4H-1,3-benzodioxin-8-yl)-7-methyl-2,3-dihydrochromen-4-ylidene]amino]thiourea.
| Compound Name | [[2-(6-bromo-4H-1,3-benzodioxin-8-yl)-7-methyl-2,3-dihydrochromen-4-ylidene]amino]thiourea |
|---|---|
| PubChem CID | 4967809 |
| Molecular Formula | C19H18BrN3O3S |
| Molecular Weight | 448.34 g/mol |
| Exact Mass | 447.03 |
| IUPAC Name | [[2-(6-bromo-4H-1,3-benzodioxin-8-yl)-7-methyl-2,3-dihydrochromen-4-ylidene]amino]thiourea |
| SMILES | Cc1ccc2c(c1)OC(c1cc(Br)cc3c1OCOC3)CC2=NNC(N)=S |
| InChI | InChI=1S/C19H18BrN3O3S/c1-10-2-3-13-15(22-23-19(21)27)7-17(26-16(13)4-10)14-6-12(20)5-11-8-24-9-25-18(11)14/h2-6,17H,7-9H2,1H3,(H3,21,23,27) |
| InChIKey | KRXQAUHVNXDCGI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|