C23H20ClN3O5 — CID 4967849
11-[5-(2-chloro-4-nitrophenyl)-2-methylfuran-3-carbonyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 4967849) has the molecular formula C23H20ClN3O5 and a molecular weight of 453.88 g/mol. Its IUPAC name is 11-[5-(2-chloro-4-nitrophenyl)-2-methylfuran-3-carbonyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | 11-[5-(2-chloro-4-nitrophenyl)-2-methylfuran-3-carbonyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 4967849 |
| Molecular Formula | C23H20ClN3O5 |
| Molecular Weight | 453.88 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | 11-[5-(2-chloro-4-nitrophenyl)-2-methylfuran-3-carbonyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | Cc1oc(-c2ccc([N+](=O)[O-])cc2Cl)cc1C(=O)N1CC2CC(C1)c1cccc(=O)n1C2 |
| InChI | InChI=1S/C23H20ClN3O5/c1-13-18(9-21(32-13)17-6-5-16(27(30)31)8-19(17)24)23(29)25-10-14-7-15(12-25)20-3-2-4-22(28)26(20)11-14/h2-6,8-9,14-15H,7,10-12H2,1H3 |
| InChIKey | PUMNUWCPLQYGHN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 98.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.88 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|