C33H31NO8 — CID 4968138
2-methoxyethyl 2-[1-(3,4-dimethoxyphenyl)-8,9-dimethoxy-2-phenylpyrrolo[2,1-a]isoquinolin-3-yl]-2-oxoacetate (PubChem CID 4968138) has the molecular formula C33H31NO8 and a molecular weight of 569.61 g/mol. Its IUPAC name is 2-methoxyethyl 2-[1-(3,4-dimethoxyphenyl)-8,9-dimethoxy-2-phenylpyrrolo[2,1-a]isoquinolin-3-yl]-2-oxoacetate.
| Compound Name | 2-methoxyethyl 2-[1-(3,4-dimethoxyphenyl)-8,9-dimethoxy-2-phenylpyrrolo[2,1-a]isoquinolin-3-yl]-2-oxoacetate |
|---|---|
| PubChem CID | 4968138 |
| Molecular Formula | C33H31NO8 |
| Molecular Weight | 569.61 g/mol |
| Exact Mass | 569.20 |
| IUPAC Name | 2-methoxyethyl 2-[1-(3,4-dimethoxyphenyl)-8,9-dimethoxy-2-phenylpyrrolo[2,1-a]isoquinolin-3-yl]-2-oxoacetate |
| SMILES | COCCOC(=O)C(=O)c1c(-c2ccccc2)c(-c2ccc(OC)c(OC)c2)c2c3cc(OC)c(OC)cc3ccn12 |
| InChI | InChI=1S/C33H31NO8/c1-37-15-16-42-33(36)32(35)31-28(20-9-7-6-8-10-20)29(22-11-12-24(38-2)25(18-22)39-3)30-23-19-27(41-5)26(40-4)17-21(23)13-14-34(30)31/h6-14,17-19H,15-16H2,1-5H3 |
| InChIKey | FBIQGWLLBSBJQK-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 93.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.61 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|