About 3-ethyl-2-ethylimino-4-methyl-N-phenyl-1,3-thiazole-5-carboxamide
3-ethyl-2-ethylimino-4-methyl-N-phenyl-1,3-thiazole-5-carboxamide (PubChem CID 4968583) has the molecular formula C15H19N3OS
and a molecular weight of 289.40 g/mol. Its IUPAC name is 3-ethyl-2-ethylimino-4-methyl-N-phenyl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-ethyl-2-ethylimino-4-methyl-N-phenyl-1,3-thiazole-5-carboxamide |
| PubChem CID | 4968583 |
| Molecular Formula | C15H19N3OS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 3-ethyl-2-ethylimino-4-methyl-N-phenyl-1,3-thiazole-5-carboxamide |
| SMILES | CC/N=c1\sc(C(=O)Nc2ccccc2)c(C)n1CC |
| InChI | InChI=1S/C15H19N3OS/c1-4-16-15-18(5-2)11(3)13(20-15)14(19)17-12-9-7-6-8-10-12/h6-10H,4-5H2,1-3H3,(H,17,19)/b16-15- |
| InChIKey | LHPRNNDRKOGVCJ-NXVVXOECSA-N |
| XLogP | 3.05 |
| TPSA | 46.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-2-ethylimino-4-methyl-N-phenyl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-2-ethylimino-4-methyl-N-phenyl-1,3-thiazole-5-carboxamide?
The IUPAC name of 3-ethyl-2-ethylimino-4-methyl-N-phenyl-1,3-thiazole-5-carboxamide (CID 4968583) is 3-ethyl-2-ethylimino-4-methyl-N-phenyl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 3-ethyl-2-ethylimino-4-methyl-N-phenyl-1,3-thiazole-5-carboxamide?
The canonical SMILES for 3-ethyl-2-ethylimino-4-methyl-N-phenyl-1,3-thiazole-5-carboxamide is CC/N=c1\sc(C(=O)Nc2ccccc2)c(C)n1CC.
What is the InChIKey of 3-ethyl-2-ethylimino-4-methyl-N-phenyl-1,3-thiazole-5-carboxamide?
The InChIKey is LHPRNNDRKOGVCJ-NXVVXOECSA-N. The full InChI is InChI=1S/C15H19N3OS/c1-4-16-15-18(5-2)11(3)13(20-15)14(19)17-12-9-7-6-8-10-12/h6-10H,4-5H2,1-3H3,(H,17,19)/b16-15-.
What are the key properties of 3-ethyl-2-ethylimino-4-methyl-N-phenyl-1,3-thiazole-5-carboxamide?
3-ethyl-2-ethylimino-4-methyl-N-phenyl-1,3-thiazole-5-carboxamide has a molecular weight of 289.40 g/mol, XLogP of 3.05, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-2-ethylimino-4-methyl-N-phenyl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 4968583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).