C27H26FN5O4S2 — CID 4968789
2-[1-[[4-(2-fluorophenyl)-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 4968789) has the molecular formula C27H26FN5O4S2 and a molecular weight of 567.67 g/mol. Its IUPAC name is 2-[1-[[4-(2-fluorophenyl)-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-[1-[[4-(2-fluorophenyl)-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 4968789 |
| Molecular Formula | C27H26FN5O4S2 |
| Molecular Weight | 567.67 g/mol |
| Exact Mass | 567.14 |
| IUPAC Name | 2-[1-[[4-(2-fluorophenyl)-5-(3,4,5-trimethoxyphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]-5,6-dimethyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | COc1cc(-c2nnc(SC(C)c3nc4sc(C)c(C)c4c(=O)[nH]3)n2-c2ccccc2F)cc(OC)c1OC |
| InChI | InChI=1S/C27H26FN5O4S2/c1-13-14(2)38-26-21(13)25(34)29-23(30-26)15(3)39-27-32-31-24(33(27)18-10-8-7-9-17(18)28)16-11-19(35-4)22(37-6)20(12-16)36-5/h7-12,15H,1-6H3,(H,29,30,34) |
| InChIKey | ZUDHRSPWNPZOOR-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 104.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.67 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |