C17H15F2N3S — CID 4968925
N-benzyl-5-(3,4-difluorophenyl)-3-methyl-6H-1,3,4-thiadiazin-2-imine (PubChem CID 4968925) has the molecular formula C17H15F2N3S and a molecular weight of 331.39 g/mol. Its IUPAC name is N-benzyl-5-(3,4-difluorophenyl)-3-methyl-6H-1,3,4-thiadiazin-2-imine.
| Compound Name | N-benzyl-5-(3,4-difluorophenyl)-3-methyl-6H-1,3,4-thiadiazin-2-imine |
|---|---|
| PubChem CID | 4968925 |
| Molecular Formula | C17H15F2N3S |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | N-benzyl-5-(3,4-difluorophenyl)-3-methyl-6H-1,3,4-thiadiazin-2-imine |
| SMILES | CN1N=C(c2ccc(F)c(F)c2)CS/C1=N\Cc1ccccc1 |
| InChI | InChI=1S/C17H15F2N3S/c1-22-17(20-10-12-5-3-2-4-6-12)23-11-16(21-22)13-7-8-14(18)15(19)9-13/h2-9H,10-11H2,1H3/b20-17- |
| InChIKey | POSCETJONNOEJC-JZJYNLBNSA-N |
| XLogP | 3.90 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|